C16H11N3O3S — CID 7372530
(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 1H-indazole-3-carboxylate (PubChem CID 7372530) has the molecular formula C16H11N3O3S and a molecular weight of 325.35 g/mol. Its IUPAC name is (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 1H-indazole-3-carboxylate.
| Compound Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 7372530 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 1H-indazole-3-carboxylate |
| SMILES | O=C(OCc1coc(-c2cccs2)n1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C16H11N3O3S/c20-16(14-11-4-1-2-5-12(11)18-19-14)22-9-10-8-21-15(17-10)13-6-3-7-23-13/h1-8H,9H2,(H,18,19) |
| InChIKey | RRPOKRKUWABFTJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |