C20H15NO3S — CID 7782747
(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-naphthalen-1-ylacetate (PubChem CID 7782747) has the molecular formula C20H15NO3S and a molecular weight of 349.41 g/mol. Its IUPAC name is (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-naphthalen-1-ylacetate.
| Compound Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 7782747 |
| Molecular Formula | C20H15NO3S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-naphthalen-1-ylacetate |
| SMILES | O=C(Cc1cccc2ccccc12)OCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C20H15NO3S/c22-19(11-15-7-3-6-14-5-1-2-8-17(14)15)23-12-16-13-24-20(21-16)18-9-4-10-25-18/h1-10,13H,11-12H2 |
| InChIKey | GNFQJXSBUNWTGC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |