C18H13F2NO4S — CID 7996537
(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996537) has the molecular formula C18H13F2NO4S and a molecular weight of 377.37 g/mol. Its IUPAC name is (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996537 |
| Molecular Formula | C18H13F2NO4S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)OCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C18H13F2NO4S/c19-18(20)25-14-6-3-12(4-7-14)5-8-16(22)23-10-13-11-24-17(21-13)15-2-1-9-26-15/h1-9,11,18H,10H2/b8-5+ |
| InChIKey | KEWDMFWLMXRYTA-VMPITWQZSA-N |
| XLogP | 4.76 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|