C17H12FNO3S — CID 8651891
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 8651891) has the molecular formula C17H12FNO3S and a molecular weight of 329.35 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8651891 |
| Molecular Formula | C17H12FNO3S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(F)cc1)OCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C17H12FNO3S/c18-13-6-3-12(4-7-13)5-8-17(20)21-11-14-10-15(22-19-14)16-2-1-9-23-16/h1-10H,11H2/b8-5+ |
| InChIKey | RDPORRZALQGJCA-VMPITWQZSA-N |
| XLogP | 4.30 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|