C20H17NO3 — CID 16869469
[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl (Z)-3-phenylprop-2-enoate (PubChem CID 16869469) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl (Z)-3-phenylprop-2-enoate.
| Compound Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl (Z)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 16869469 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl (Z)-3-phenylprop-2-enoate |
| SMILES | Cc1ccc(-c2cc(COC(=O)/C=C\c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C20H17NO3/c1-15-7-10-17(11-8-15)19-13-18(21-24-19)14-23-20(22)12-9-16-5-3-2-4-6-16/h2-13H,14H2,1H3/b12-9- |
| InChIKey | URFPSGIAHJWBTC-XFXZXTDPSA-N |
| XLogP | 4.41 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|