C16H17NO5 — CID 16870045
[5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl (Z)-but-2-enoate (PubChem CID 16870045) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl (Z)-but-2-enoate.
| Compound Name | [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl (Z)-but-2-enoate |
|---|---|
| PubChem CID | 16870045 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl (Z)-but-2-enoate |
| SMILES | C/C=C\C(=O)OCc1cc(-c2ccc(OC)c(OC)c2)on1 |
| InChI | InChI=1S/C16H17NO5/c1-4-5-16(18)21-10-12-9-14(22-17-12)11-6-7-13(19-2)15(8-11)20-3/h4-9H,10H2,1-3H3/b5-4- |
| InChIKey | YDWMROHYYPUAPH-PLNGDYQASA-N |
| XLogP | 2.98 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|