C20H19NO6 — CID 16870103
[5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl 2-phenoxyacetate (PubChem CID 16870103) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl 2-phenoxyacetate.
| Compound Name | [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl 2-phenoxyacetate |
|---|---|
| PubChem CID | 16870103 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl 2-phenoxyacetate |
| SMILES | COc1ccc(-c2cc(COC(=O)COc3ccccc3)no2)cc1OC |
| InChI | InChI=1S/C20H19NO6/c1-23-17-9-8-14(10-19(17)24-2)18-11-15(21-27-18)12-26-20(22)13-25-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | FRAZMXOECVJSFL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |