C20H18N2O7 — CID 16870087
[5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl 4-methyl-3-nitrobenzoate (PubChem CID 16870087) has the molecular formula C20H18N2O7 and a molecular weight of 398.37 g/mol. Its IUPAC name is [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl 4-methyl-3-nitrobenzoate.
| Compound Name | [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 16870087 |
| Molecular Formula | C20H18N2O7 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl 4-methyl-3-nitrobenzoate |
| SMILES | COc1ccc(-c2cc(COC(=O)c3ccc(C)c([N+](=O)[O-])c3)no2)cc1OC |
| InChI | InChI=1S/C20H18N2O7/c1-12-4-5-14(8-16(12)22(24)25)20(23)28-11-15-10-18(29-21-15)13-6-7-17(26-2)19(9-13)27-3/h4-10H,11H2,1-3H3 |
| InChIKey | VDRMCMNZQMDUGM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 113.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|