C21H20N2O5S — CID 7785923
[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]methyl 4-methoxy-3-nitrobenzoate (PubChem CID 7785923) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is [2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]methyl 4-methoxy-3-nitrobenzoate.
| Compound Name | [2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]methyl 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 7785923 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]methyl 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)OCc2csc(-c3ccc(C(C)C)cc3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20N2O5S/c1-13(2)14-4-6-15(7-5-14)20-22-17(12-29-20)11-28-21(24)16-8-9-19(27-3)18(10-16)23(25)26/h4-10,12-13H,11H2,1-3H3 |
| InChIKey | LCZDNMSLBYPCNG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|