C17H15NO4S2 — CID 8649074
(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 3,4-dimethoxybenzoate (PubChem CID 8649074) has the molecular formula C17H15NO4S2 and a molecular weight of 361.44 g/mol. Its IUPAC name is (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 3,4-dimethoxybenzoate.
| Compound Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 8649074 |
| Molecular Formula | C17H15NO4S2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2csc(-c3ccsc3)n2)cc1OC |
| InChI | InChI=1S/C17H15NO4S2/c1-20-14-4-3-11(7-15(14)21-2)17(19)22-8-13-10-24-16(18-13)12-5-6-23-9-12/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | VLJNVJWRTYFFPH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |