C19H17NO5S — CID 7866611
[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-hydroxybenzoate (PubChem CID 7866611) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-hydroxybenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 7866611 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-hydroxybenzoate |
| SMILES | COc1ccc(-c2nc(COC(=O)c3ccc(O)cc3)cs2)cc1OC |
| InChI | InChI=1S/C19H17NO5S/c1-23-16-8-5-13(9-17(16)24-2)18-20-14(11-26-18)10-25-19(22)12-3-6-15(21)7-4-12/h3-9,11,21H,10H2,1-2H3 |
| InChIKey | UTPREFWGYSFLSY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |