C24H27NO4S — CID 7235380
[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2,3,4,5,6-pentamethylbenzoate (PubChem CID 7235380) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2,3,4,5,6-pentamethylbenzoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2,3,4,5,6-pentamethylbenzoate |
|---|---|
| PubChem CID | 7235380 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 2,3,4,5,6-pentamethylbenzoate |
| SMILES | COc1ccc(-c2nc(COC(=O)c3c(C)c(C)c(C)c(C)c3C)cs2)cc1OC |
| InChI | InChI=1S/C24H27NO4S/c1-13-14(2)16(4)22(17(5)15(13)3)24(26)29-11-19-12-30-23(25-19)18-8-9-20(27-6)21(10-18)28-7/h8-10,12H,11H2,1-7H3 |
| InChIKey | KXRQCQQGUCVOQK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |