C19H25N3O5S — CID 8863101
[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 6-(carbamoylamino)hexanoate (PubChem CID 8863101) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 6-(carbamoylamino)hexanoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8863101 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 6-(carbamoylamino)hexanoate |
| SMILES | COc1ccc(-c2nc(COC(=O)CCCCCNC(N)=O)cs2)cc1OC |
| InChI | InChI=1S/C19H25N3O5S/c1-25-15-8-7-13(10-16(15)26-2)18-22-14(12-28-18)11-27-17(23)6-4-3-5-9-21-19(20)24/h7-8,10,12H,3-6,9,11H2,1-2H3,(H3,20,21,24) |
| InChIKey | WTMYXZLBFZSSJU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|