C17H24N2O5 — CID 8860206
(5-acetyl-2-methoxyphenyl)methyl 6-(carbamoylamino)hexanoate (PubChem CID 8860206) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 6-(carbamoylamino)hexanoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8860206 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 6-(carbamoylamino)hexanoate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)CCCCCNC(N)=O |
| InChI | InChI=1S/C17H24N2O5/c1-12(20)13-7-8-15(23-2)14(10-13)11-24-16(21)6-4-3-5-9-19-17(18)22/h7-8,10H,3-6,9,11H2,1-2H3,(H3,18,19,22) |
| InChIKey | BAXMMSODDSUCPX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|