C18H19NO6S — CID 46670202
(5-acetyl-2-methoxyphenyl)methyl 4-(methylsulfamoyl)benzoate (PubChem CID 46670202) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 4-(methylsulfamoyl)benzoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 4-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46670202 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 4-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)OCc2cc(C(C)=O)ccc2OC)cc1 |
| InChI | InChI=1S/C18H19NO6S/c1-12(20)14-6-9-17(24-3)15(10-14)11-25-18(21)13-4-7-16(8-5-13)26(22,23)19-2/h4-10,19H,11H2,1-3H3 |
| InChIKey | DSNWOZZRJKWPGA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |