C19H19NO6 — CID 8678507
(5-acetyl-2-methoxyphenyl)methyl 4-(2-amino-2-oxoethoxy)benzoate (PubChem CID 8678507) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 4-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 4-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 8678507 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 4-(2-amino-2-oxoethoxy)benzoate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)c1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C19H19NO6/c1-12(21)14-5-8-17(24-2)15(9-14)10-26-19(23)13-3-6-16(7-4-13)25-11-18(20)22/h3-9H,10-11H2,1-2H3,(H2,20,22) |
| InChIKey | CHNRZZPGAVYGSD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |