C20H22O6 — CID 2629792
(5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate (PubChem CID 2629792) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate.
| Compound Name | (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2629792 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate |
| SMILES | CCOc1ccc(C(C)=O)cc1COC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C20H22O6/c1-5-25-19-7-6-14(13(2)21)8-16(19)12-26-20(22)15-9-17(23-3)11-18(10-15)24-4/h6-11H,5,12H2,1-4H3 |
| InChIKey | YJUOUSQCGIEDRT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |