(5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate

C20H22O6 — CID 2629792

IUPAC(5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate
SMILESCCOc1ccc(C(C)=O)cc1COC(=O)c1cc(OC)cc(OC)c1
InChIInChI=1S/C20H22O6/c1-5-25-19-7-6-14(13(2)21)8-16(19)12-26-20(22)15-9-17(23-3)11-18(10-15)24-4/h6-11H,5,12H2,1-4H3
InChIKeyYJUOUSQCGIEDRT-UHFFFAOYSA-N
MW358.39 g/mol
LogP3.66
Rot. Bonds8

About (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate

(5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate (PubChem CID 2629792) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate.

Molecular Properties

Compound Name(5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate
PubChem CID2629792
Molecular FormulaC20H22O6
Molecular Weight358.39 g/mol
Exact Mass358.14
IUPAC Name(5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate
SMILESCCOc1ccc(C(C)=O)cc1COC(=O)c1cc(OC)cc(OC)c1
InChIInChI=1S/C20H22O6/c1-5-25-19-7-6-14(13(2)21)8-16(19)12-26-20(22)15-9-17(23-3)11-18(10-15)24-4/h6-11H,5,12H2,1-4H3
InChIKeyYJUOUSQCGIEDRT-UHFFFAOYSA-N
XLogP3.66
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.39
LogP ≤ 53.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate?
The IUPAC name of (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate (CID 2629792) is (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate.
What is the SMILES notation for (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate?
The canonical SMILES for (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate is CCOc1ccc(C(C)=O)cc1COC(=O)c1cc(OC)cc(OC)c1.
What is the InChIKey of (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate?
The InChIKey is YJUOUSQCGIEDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O6/c1-5-25-19-7-6-14(13(2)21)8-16(19)12-26-20(22)15-9-17(23-3)11-18(10-15)24-4/h6-11H,5,12H2,1-4H3.
What are the key properties of (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate?
(5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate has a molecular weight of 358.39 g/mol, XLogP of 3.66, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetyl-2-ethoxyphenyl)methyl 3,5-dimethoxybenzoate is sourced from PubChem (CID 2629792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).