C22H22O6 — CID 9168101
(5-acetyl-2-ethoxyphenyl)methyl 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 9168101) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | (5-acetyl-2-ethoxyphenyl)methyl 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 9168101 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (5-acetyl-2-ethoxyphenyl)methyl 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | CCOc1ccc(C(C)=O)cc1COC(=O)Cc1coc2cc(OC)ccc12 |
| InChI | InChI=1S/C22H22O6/c1-4-26-20-8-5-15(14(2)23)9-17(20)13-28-22(24)10-16-12-27-21-11-18(25-3)6-7-19(16)21/h5-9,11-12H,4,10,13H2,1-3H3 |
| InChIKey | ZEUOVKJYEZWSMI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |