2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate

C14H14O5 — CID 55327046

IUPAC2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate
SMILESCOc1ccc2c(CC(=O)OCC(C)=O)coc2c1
InChIInChI=1S/C14H14O5/c1-9(15)7-19-14(16)5-10-8-18-13-6-11(17-2)3-4-12(10)13/h3-4,6,8H,5,7H2,1-2H3
InChIKeyUVCFKJJMLKBLAE-UHFFFAOYSA-N
MW262.26 g/mol
LogP2.12
Rot. Bonds5

About 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate

2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 55327046) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate.

Molecular Properties

Compound Name2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate
PubChem CID55327046
Molecular FormulaC14H14O5
Molecular Weight262.26 g/mol
Exact Mass262.08
IUPAC Name2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate
SMILESCOc1ccc2c(CC(=O)OCC(C)=O)coc2c1
InChIInChI=1S/C14H14O5/c1-9(15)7-19-14(16)5-10-8-18-13-6-11(17-2)3-4-12(10)13/h3-4,6,8H,5,7H2,1-2H3
InChIKeyUVCFKJJMLKBLAE-UHFFFAOYSA-N
XLogP2.12
TPSA65.74 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.26
LogP ≤ 52.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate?
The IUPAC name of 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate (CID 55327046) is 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate.
What is the SMILES notation for 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate?
The canonical SMILES for 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate is COc1ccc2c(CC(=O)OCC(C)=O)coc2c1.
What is the InChIKey of 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate?
The InChIKey is UVCFKJJMLKBLAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O5/c1-9(15)7-19-14(16)5-10-8-18-13-6-11(17-2)3-4-12(10)13/h3-4,6,8H,5,7H2,1-2H3.
What are the key properties of 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate?
2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate has a molecular weight of 262.26 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 2-(6-methoxy-1-benzofuran-3-yl)acetate is sourced from PubChem (CID 55327046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).