C18H23NO5 — CID 7901969
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 7901969) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7901969 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)Cc1coc2cc(OC)ccc12 |
| InChI | InChI=1S/C18H23NO5/c1-4-5-12(2)19-17(20)11-24-18(21)8-13-10-23-16-9-14(22-3)6-7-15(13)16/h6-7,9-10,12H,4-5,8,11H2,1-3H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | WZYFPKNEJMYQPK-GFCCVEGCSA-N |
| XLogP | 2.83 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |