C18H16O4 — CID 8961126
benzyl 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 8961126) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is benzyl 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | benzyl 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8961126 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | benzyl 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(CC(=O)OCc3ccccc3)coc2c1 |
| InChI | InChI=1S/C18H16O4/c1-20-15-7-8-16-14(12-21-17(16)10-15)9-18(19)22-11-13-5-3-2-4-6-13/h2-8,10,12H,9,11H2,1H3 |
| InChIKey | QNURFCRTZCSJCZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |