C18H17NO3 — CID 2598100
N-benzyl-2-(6-methoxy-1-benzofuran-3-yl)acetamide (PubChem CID 2598100) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-benzyl-2-(6-methoxy-1-benzofuran-3-yl)acetamide.
| Compound Name | N-benzyl-2-(6-methoxy-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 2598100 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-benzyl-2-(6-methoxy-1-benzofuran-3-yl)acetamide |
| SMILES | COc1ccc2c(CC(=O)NCc3ccccc3)coc2c1 |
| InChI | InChI=1S/C18H17NO3/c1-21-15-7-8-16-14(12-22-17(16)10-15)9-18(20)19-11-13-5-3-2-4-6-13/h2-8,10,12H,9,11H2,1H3,(H,19,20) |
| InChIKey | NYZDLPSYLSQNER-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |