C18H16N2O5 — CID 8895546
4-hydroxy-N'-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]benzohydrazide (PubChem CID 8895546) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-hydroxy-N'-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]benzohydrazide.
| Compound Name | 4-hydroxy-N'-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8895546 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-hydroxy-N'-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]benzohydrazide |
| SMILES | COc1ccc2c(CC(=O)NNC(=O)c3ccc(O)cc3)coc2c1 |
| InChI | InChI=1S/C18H16N2O5/c1-24-14-6-7-15-12(10-25-16(15)9-14)8-17(22)19-20-18(23)11-2-4-13(21)5-3-11/h2-7,9-10,21H,8H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | SFXRZXRUWWHSSW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|