C19H18N2O4 — CID 2492500
N'-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]-4-methylbenzohydrazide (PubChem CID 2492500) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N'-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]-4-methylbenzohydrazide.
| Compound Name | N'-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 2492500 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N'-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]-4-methylbenzohydrazide |
| SMILES | COc1ccc2c(CC(=O)NNC(=O)c3ccc(C)cc3)coc2c1 |
| InChI | InChI=1S/C19H18N2O4/c1-12-3-5-13(6-4-12)19(23)21-20-18(22)9-14-11-25-17-10-15(24-2)7-8-16(14)17/h3-8,10-11H,9H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ORSRYASEUGASOJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|