C14H17NO4 — CID 29290752
2-(6-methoxy-1-benzofuran-3-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 29290752) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-(6-methoxy-1-benzofuran-3-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(6-methoxy-1-benzofuran-3-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 29290752 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(6-methoxy-1-benzofuran-3-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cc1coc2cc(OC)ccc12 |
| InChI | InChI=1S/C14H17NO4/c1-17-6-5-15-14(16)7-10-9-19-13-8-11(18-2)3-4-12(10)13/h3-4,8-9H,5-7H2,1-2H3,(H,15,16) |
| InChIKey | FSTHOGIQISVVNO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|