C18H20N4O4 — CID 34988498
N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-(6-methoxy-1-benzofuran-3-yl)acetohydrazide (PubChem CID 34988498) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-(6-methoxy-1-benzofuran-3-yl)acetohydrazide.
| Compound Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-(6-methoxy-1-benzofuran-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 34988498 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-(6-methoxy-1-benzofuran-3-yl)acetohydrazide |
| SMILES | COc1ccc2c(CC(=O)NNC(=O)Cn3nc(C)cc3C)coc2c1 |
| InChI | InChI=1S/C18H20N4O4/c1-11-6-12(2)22(21-11)9-18(24)20-19-17(23)7-13-10-26-16-8-14(25-3)4-5-15(13)16/h4-6,8,10H,7,9H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | HOQNEHYZLDVDPG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|