C21H24N4O5 — CID 34390006
N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanehydrazide (PubChem CID 34390006) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanehydrazide.
| Compound Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanehydrazide |
|---|---|
| PubChem CID | 34390006 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanehydrazide |
| SMILES | COc1ccc2c(C)c(CCC(=O)NNC(=O)Cn3nc(C)cc3C)c(=O)oc2c1 |
| InChI | InChI=1S/C21H24N4O5/c1-12-9-13(2)25(24-12)11-20(27)23-22-19(26)8-7-17-14(3)16-6-5-15(29-4)10-18(16)30-21(17)28/h5-6,9-10H,7-8,11H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | ZEQZIKCNTVOXOR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|