C17H16N2O4S — CID 16604979
3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 16604979) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 16604979 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)Nc3nccs3)c(=O)oc2c1 |
| InChI | InChI=1S/C17H16N2O4S/c1-10-12-4-3-11(22-2)9-14(12)23-16(21)13(10)5-6-15(20)19-17-18-7-8-24-17/h3-4,7-9H,5-6H2,1-2H3,(H,18,19,20) |
| InChIKey | MBGYJKFMAPPEGG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|