C19H19N3O4S — CID 18103435
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide (PubChem CID 18103435) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
|---|---|
| PubChem CID | 18103435 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)Nc3nnc(C4CC4)s3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H19N3O4S/c1-10-13-6-5-12(25-2)9-15(13)26-18(24)14(10)7-8-16(23)20-19-22-21-17(27-19)11-3-4-11/h5-6,9,11H,3-4,7-8H2,1-2H3,(H,20,22,23) |
| InChIKey | UPESPMYEXZPWBT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|