C24H23NO8 — CID 46650496
dimethyl 5-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]benzene-1,3-dicarboxylate (PubChem CID 46650496) has the molecular formula C24H23NO8 and a molecular weight of 453.45 g/mol. Its IUPAC name is dimethyl 5-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46650496 |
| Molecular Formula | C24H23NO8 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | dimethyl 5-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CCc2c(C)c3ccc(OC)cc3oc2=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C24H23NO8/c1-13-18-6-5-17(30-2)12-20(18)33-24(29)19(13)7-8-21(26)25-16-10-14(22(27)31-3)9-15(11-16)23(28)32-4/h5-6,9-12H,7-8H2,1-4H3,(H,25,26) |
| InChIKey | VHDSJTMCVIALEA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|