C25H25NO8 — CID 33328017
methyl 3-[[2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyloxy]acetyl]amino]-4-methylbenzoate (PubChem CID 33328017) has the molecular formula C25H25NO8 and a molecular weight of 467.47 g/mol. Its IUPAC name is methyl 3-[[2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyloxy]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyloxy]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 33328017 |
| Molecular Formula | C25H25NO8 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | methyl 3-[[2-[3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoyloxy]acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)COC(=O)CCc2c(C)c3ccc(OC)cc3oc2=O)c1 |
| InChI | InChI=1S/C25H25NO8/c1-14-5-6-16(24(29)32-4)11-20(14)26-22(27)13-33-23(28)10-9-19-15(2)18-8-7-17(31-3)12-21(18)34-25(19)30/h5-8,11-12H,9-10,13H2,1-4H3,(H,26,27) |
| InChIKey | SKIIRCFJRDXEAV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|