C24H23Cl2NO6 — CID 46660894
[2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate (PubChem CID 46660894) has the molecular formula C24H23Cl2NO6 and a molecular weight of 492.36 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate |
|---|---|
| PubChem CID | 46660894 |
| Molecular Formula | C24H23Cl2NO6 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanoate |
| SMILES | COc1ccc2c(C)c(CCC(=O)OCC(=O)NC(C)c3ccc(Cl)c(Cl)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H23Cl2NO6/c1-13-17-6-5-16(31-3)11-21(17)33-24(30)18(13)7-9-23(29)32-12-22(28)27-14(2)15-4-8-19(25)20(26)10-15/h4-6,8,10-11,14H,7,9,12H2,1-3H3,(H,27,28) |
| InChIKey | ZQDLWAQASKTTTL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|