C19H19Cl2NO3 — CID 7957969
[2-[[(1S)-1-(3,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 3-phenylpropanoate (PubChem CID 7957969) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is [2-[[(1S)-1-(3,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 3-phenylpropanoate.
| Compound Name | [2-[[(1S)-1-(3,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 7957969 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [2-[[(1S)-1-(3,4-dichlorophenyl)ethyl]amino]-2-oxoethyl] 3-phenylpropanoate |
| SMILES | C[C@H](NC(=O)COC(=O)CCc1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO3/c1-13(15-8-9-16(20)17(21)11-15)22-18(23)12-25-19(24)10-7-14-5-3-2-4-6-14/h2-6,8-9,11,13H,7,10,12H2,1H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | SHNPZTNTFPEMJZ-ZDUSSCGKSA-N |
| XLogP | 4.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |