C12H16Cl2N2O2 — CID 79473884
2-(2-aminoethoxy)-N-[1-(3,4-dichlorophenyl)ethyl]acetamide (PubChem CID 79473884) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-[1-(3,4-dichlorophenyl)ethyl]acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-[1-(3,4-dichlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 79473884 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-(2-aminoethoxy)-N-[1-(3,4-dichlorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)COCCN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-8(16-12(17)7-18-5-4-15)9-2-3-10(13)11(14)6-9/h2-3,6,8H,4-5,7,15H2,1H3,(H,16,17) |
| InChIKey | VPBQKRORUZWCON-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|