C13H18ClNO2 — CID 107941741
N-[(1R)-1-(4-chlorophenyl)ethyl]-2-propoxyacetamide (PubChem CID 107941741) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-2-propoxyacetamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-propoxyacetamide |
|---|---|
| PubChem CID | 107941741 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-propoxyacetamide |
| SMILES | CCCOCC(=O)N[C@H](C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO2/c1-3-8-17-9-13(16)15-10(2)11-4-6-12(14)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | YRSWKLKYZXAMRD-SNVBAGLBSA-N |
| XLogP | 2.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|