C17H18Cl2N2O5 — CID 55427580
[2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)propanoate (PubChem CID 55427580) has the molecular formula C17H18Cl2N2O5 and a molecular weight of 401.25 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)propanoate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 55427580 |
| Molecular Formula | C17H18Cl2N2O5 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)propanoate |
| SMILES | CC(NC(=O)COC(=O)CCN1C(=O)CCC1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O5/c1-10(11-2-3-12(18)13(19)8-11)20-14(22)9-26-17(25)6-7-21-15(23)4-5-16(21)24/h2-3,8,10H,4-7,9H2,1H3,(H,20,22) |
| InChIKey | PHXCKZVKCSFVNV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|