C15H16ClFN2O3 — CID 47071121
N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 47071121) has the molecular formula C15H16ClFN2O3 and a molecular weight of 326.75 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 47071121 |
| Molecular Formula | C15H16ClFN2O3 |
| Molecular Weight | 326.75 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | CC(NC(=O)CCN1C(=O)CCC1=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H16ClFN2O3/c1-9(10-2-3-12(17)11(16)8-10)18-13(20)6-7-19-14(21)4-5-15(19)22/h2-3,8-9H,4-7H2,1H3,(H,18,20) |
| InChIKey | SAKZJTSPXOMPNI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|