C17H24ClFN2O — CID 119745659
N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-piperidin-3-ylbutanamide (PubChem CID 119745659) has the molecular formula C17H24ClFN2O and a molecular weight of 326.84 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119745659 |
| Molecular Formula | C17H24ClFN2O |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(NC(=O)CC(C)C1CCCNC1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H24ClFN2O/c1-11(14-4-3-7-20-10-14)8-17(22)21-12(2)13-5-6-16(19)15(18)9-13/h5-6,9,11-12,14,20H,3-4,7-8,10H2,1-2H3,(H,21,22) |
| InChIKey | ILSGEPBPTOYNBI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |