C18H27BrN2O2 — CID 119694049
N-[1-(3-bromo-4-methoxyphenyl)ethyl]-3-piperidin-3-ylbutanamide (PubChem CID 119694049) has the molecular formula C18H27BrN2O2 and a molecular weight of 383.33 g/mol. Its IUPAC name is N-[1-(3-bromo-4-methoxyphenyl)ethyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[1-(3-bromo-4-methoxyphenyl)ethyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119694049 |
| Molecular Formula | C18H27BrN2O2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-[1-(3-bromo-4-methoxyphenyl)ethyl]-3-piperidin-3-ylbutanamide |
| SMILES | COc1ccc(C(C)NC(=O)CC(C)C2CCCNC2)cc1Br |
| InChI | InChI=1S/C18H27BrN2O2/c1-12(15-5-4-8-20-11-15)9-18(22)21-13(2)14-6-7-17(23-3)16(19)10-14/h6-7,10,12-13,15,20H,4-5,8-9,11H2,1-3H3,(H,21,22) |
| InChIKey | UOMNXLNPGRRYIK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |