C17H23Cl2FN2O — CID 119716767
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-piperidin-3-ylbutanamide (PubChem CID 119716767) has the molecular formula C17H23Cl2FN2O and a molecular weight of 361.29 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119716767 |
| Molecular Formula | C17H23Cl2FN2O |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(NC(=O)CC(C)C1CCCNC1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C17H23Cl2FN2O/c1-10(12-4-3-7-21-9-12)8-15(23)22-11(2)16-13(18)5-6-14(20)17(16)19/h5-6,10-12,21H,3-4,7-9H2,1-2H3,(H,22,23) |
| InChIKey | ABOOLPBYVQKICV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|