C20H26Cl2N2OS — CID 119736178
N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119736178) has the molecular formula C20H26Cl2N2OS and a molecular weight of 413.41 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119736178 |
| Molecular Formula | C20H26Cl2N2OS |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NC(c1ccc(Cl)cc1)c1cccs1)C1CCCNC1.Cl |
| InChI | InChI=1S/C20H25ClN2OS.ClH/c1-14(16-4-2-10-22-13-16)12-19(24)23-20(18-5-3-11-25-18)15-6-8-17(21)9-7-15;/h3,5-9,11,14,16,20,22H,2,4,10,12-13H2,1H3,(H,23,24);1H |
| InChIKey | WMMBJYKMDCEGRP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |