C16H18Cl2N2OS — CID 119736196
N-[(4-chlorophenyl)-thiophen-2-ylmethyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119736196) has the molecular formula C16H18Cl2N2OS and a molecular weight of 357.31 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-thiophen-2-ylmethyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[(4-chlorophenyl)-thiophen-2-ylmethyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119736196 |
| Molecular Formula | C16H18Cl2N2OS |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-[(4-chlorophenyl)-thiophen-2-ylmethyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC(c1ccc(Cl)cc1)c1cccs1)C1CCNC1 |
| InChI | InChI=1S/C16H17ClN2OS.ClH/c17-13-5-3-11(4-6-13)15(14-2-1-9-21-14)19-16(20)12-7-8-18-10-12;/h1-6,9,12,15,18H,7-8,10H2,(H,19,20);1H |
| InChIKey | LLQGKWLRMALQAE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |