C18H17ClF2N2O — CID 119806108
N-[(2-chlorophenyl)-(2,5-difluorophenyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 119806108) has the molecular formula C18H17ClF2N2O and a molecular weight of 350.80 g/mol. Its IUPAC name is N-[(2-chlorophenyl)-(2,5-difluorophenyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[(2-chlorophenyl)-(2,5-difluorophenyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119806108 |
| Molecular Formula | C18H17ClF2N2O |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[(2-chlorophenyl)-(2,5-difluorophenyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NC(c1cc(F)ccc1F)c1ccccc1Cl)C1CCNC1 |
| InChI | InChI=1S/C18H17ClF2N2O/c19-15-4-2-1-3-13(15)17(14-9-12(20)5-6-16(14)21)23-18(24)11-7-8-22-10-11/h1-6,9,11,17,22H,7-8,10H2,(H,23,24) |
| InChIKey | KNRZVRLVYWZPCS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |