C13H15ClN2O3 — CID 107315387
(2R)-2-(2-chlorophenyl)-2-(pyrrolidine-3-carbonylamino)acetic acid (PubChem CID 107315387) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-(pyrrolidine-3-carbonylamino)acetic acid.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-(pyrrolidine-3-carbonylamino)acetic acid |
|---|---|
| PubChem CID | 107315387 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-(pyrrolidine-3-carbonylamino)acetic acid |
| SMILES | O=C(N[C@@H](C(=O)O)c1ccccc1Cl)C1CCNC1 |
| InChI | InChI=1S/C13H15ClN2O3/c14-10-4-2-1-3-9(10)11(13(18)19)16-12(17)8-5-6-15-7-8/h1-4,8,11,15H,5-7H2,(H,16,17)(H,18,19)/t8?,11-/m1/s1 |
| InChIKey | IODIHWSBFLRWAW-QHDYGNBISA-N |
| XLogP | 1.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |