C12H13ClN2O3S — CID 107315327
(2R)-2-(2-chlorophenyl)-2-(1,3-thiazolidine-4-carbonylamino)acetic acid (PubChem CID 107315327) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-(1,3-thiazolidine-4-carbonylamino)acetic acid.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-(1,3-thiazolidine-4-carbonylamino)acetic acid |
|---|---|
| PubChem CID | 107315327 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-(1,3-thiazolidine-4-carbonylamino)acetic acid |
| SMILES | O=C(N[C@@H](C(=O)O)c1ccccc1Cl)C1CSCN1 |
| InChI | InChI=1S/C12H13ClN2O3S/c13-8-4-2-1-3-7(8)10(12(17)18)15-11(16)9-5-19-6-14-9/h1-4,9-10,14H,5-6H2,(H,15,16)(H,17,18)/t9?,10-/m1/s1 |
| InChIKey | OGLZZDQYXNKRDM-QVDQXJPCSA-N |
| XLogP | 1.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |