C13H16N2O3S — CID 55128819
2-phenyl-3-(1,3-thiazolidine-4-carbonylamino)propanoic acid (PubChem CID 55128819) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-phenyl-3-(1,3-thiazolidine-4-carbonylamino)propanoic acid.
| Compound Name | 2-phenyl-3-(1,3-thiazolidine-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 55128819 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-phenyl-3-(1,3-thiazolidine-4-carbonylamino)propanoic acid |
| SMILES | O=C(NCC(C(=O)O)c1ccccc1)C1CSCN1 |
| InChI | InChI=1S/C13H16N2O3S/c16-12(11-7-19-8-15-11)14-6-10(13(17)18)9-4-2-1-3-5-9/h1-5,10-11,15H,6-8H2,(H,14,16)(H,17,18) |
| InChIKey | QOVGLQDVVIMEHK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |