C16H22N2OS — CID 110661652
N-(3-cyclopropyl-3-phenylpropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 110661652) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N-(3-cyclopropyl-3-phenylpropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-cyclopropyl-3-phenylpropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 110661652 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-(3-cyclopropyl-3-phenylpropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCC(c1ccccc1)C1CC1)C1CSCN1 |
| InChI | InChI=1S/C16H22N2OS/c19-16(15-10-20-11-18-15)17-9-8-14(13-6-7-13)12-4-2-1-3-5-12/h1-5,13-15,18H,6-11H2,(H,17,19) |
| InChIKey | VYUGGXFENMOTOS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |