C9H16N2O3S — CID 80539990
2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid (PubChem CID 80539990) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid.
| Compound Name | 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 80539990 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid |
| SMILES | CC(CCNC(=O)C1CSCN1)C(=O)O |
| InChI | InChI=1S/C9H16N2O3S/c1-6(9(13)14)2-3-10-8(12)7-4-15-5-11-7/h6-7,11H,2-5H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | QAXDISICIQWDCU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |