2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid

C9H16N2O3S — CID 80539990

IUPAC2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid
SMILESCC(CCNC(=O)C1CSCN1)C(=O)O
InChIInChI=1S/C9H16N2O3S/c1-6(9(13)14)2-3-10-8(12)7-4-15-5-11-7/h6-7,11H,2-5H2,1H3,(H,10,12)(H,13,14)
InChIKeyQAXDISICIQWDCU-UHFFFAOYSA-N
MW232.30 g/mol
LogP-0.12
Rot. Bonds5

About 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid

2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid (PubChem CID 80539990) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid.

Molecular Properties

Compound Name2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid
PubChem CID80539990
Molecular FormulaC9H16N2O3S
Molecular Weight232.30 g/mol
Exact Mass232.09
IUPAC Name2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid
SMILESCC(CCNC(=O)C1CSCN1)C(=O)O
InChIInChI=1S/C9H16N2O3S/c1-6(9(13)14)2-3-10-8(12)7-4-15-5-11-7/h6-7,11H,2-5H2,1H3,(H,10,12)(H,13,14)
InChIKeyQAXDISICIQWDCU-UHFFFAOYSA-N
XLogP-0.12
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.30
LogP ≤ 5-0.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid?
The IUPAC name of 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid (CID 80539990) is 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid.
What is the SMILES notation for 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid?
The canonical SMILES for 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid is CC(CCNC(=O)C1CSCN1)C(=O)O.
What is the InChIKey of 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid?
The InChIKey is QAXDISICIQWDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3S/c1-6(9(13)14)2-3-10-8(12)7-4-15-5-11-7/h6-7,11H,2-5H2,1H3,(H,10,12)(H,13,14).
What are the key properties of 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid?
2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid has a molecular weight of 232.30 g/mol, XLogP of -0.12, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(1,3-thiazolidine-4-carbonylamino)butanoic acid is sourced from PubChem (CID 80539990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).