C9H16N2O3S — CID 107565112
(2S)-2-(1,3-thiazolidine-4-carbonylamino)pentanoic acid (PubChem CID 107565112) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is (2S)-2-(1,3-thiazolidine-4-carbonylamino)pentanoic acid.
| Compound Name | (2S)-2-(1,3-thiazolidine-4-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 107565112 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (2S)-2-(1,3-thiazolidine-4-carbonylamino)pentanoic acid |
| SMILES | CCC[C@H](NC(=O)C1CSCN1)C(=O)O |
| InChI | InChI=1S/C9H16N2O3S/c1-2-3-6(9(13)14)11-8(12)7-4-15-5-10-7/h6-7,10H,2-5H2,1H3,(H,11,12)(H,13,14)/t6-,7?/m0/s1 |
| InChIKey | NKBQGJFFMFPPHT-PKPIPKONSA-N |
| XLogP | 0.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |