C8H16N2O2S — CID 83177193
N-(4-hydroxybutan-2-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 83177193) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is N-(4-hydroxybutan-2-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4-hydroxybutan-2-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 83177193 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-(4-hydroxybutan-2-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(CCO)NC(=O)C1CSCN1 |
| InChI | InChI=1S/C8H16N2O2S/c1-6(2-3-11)10-8(12)7-4-13-5-9-7/h6-7,9,11H,2-5H2,1H3,(H,10,12) |
| InChIKey | RMMQECDAEVXNEB-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |